C26H39NO4S2 — CID 25423367
[2-[(8R,9R,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] N,N-diethylcarbamodithioate (PubChem CID 25423367) has the molecular formula C26H39NO4S2 and a molecular weight of 493.74 g/mol. Its IUPAC name is [2-[(8R,9R,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-[(8R,9R,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 25423367 |
| Molecular Formula | C26H39NO4S2 |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | [2-[(8R,9R,10R,11S,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)[C@@]1(O)CC[C@H]2[C@H]3CCC4=CC(=O)CC[C@]4(C)[C@@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C26H39NO4S2/c1-5-27(6-2)23(32)33-15-21(30)26(31)12-10-19-18-8-7-16-13-17(28)9-11-24(16,3)22(18)20(29)14-25(19,26)4/h13,18-20,22,29,31H,5-12,14-15H2,1-4H3/t18-,19+,20+,22+,24+,25+,26+/m1/s1 |
| InChIKey | WEZGTTICSWUZNC-UWRYUBRASA-N |
| XLogP | 4.15 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|