C25H36O5S2 — CID 51449185
O-propan-2-yl [2-[(8R,9S,10R,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]sulfanylmethanethioate (PubChem CID 51449185) has the molecular formula C25H36O5S2 and a molecular weight of 480.69 g/mol. Its IUPAC name is O-propan-2-yl [2-[(8R,9S,10R,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]sulfanylmethanethioate.
| Compound Name | O-propan-2-yl [2-[(8R,9S,10R,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]sulfanylmethanethioate |
|---|---|
| PubChem CID | 51449185 |
| Molecular Formula | C25H36O5S2 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | O-propan-2-yl [2-[(8R,9S,10R,11S,13S,14R,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl]sulfanylmethanethioate |
| SMILES | CC(C)OC(=S)SCC(=O)[C@@]1(O)CC[C@@H]2[C@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3[C@@H](O)C[C@@]21C |
| InChI | InChI=1S/C25H36O5S2/c1-14(2)30-22(31)32-13-20(28)25(29)10-8-18-17-6-5-15-11-16(26)7-9-23(15,3)21(17)19(27)12-24(18,25)4/h11,14,17-19,21,27,29H,5-10,12-13H2,1-4H3/t17-,18-,19+,21-,23+,24+,25+/m1/s1 |
| InChIKey | YRFRIBDYZIIIDT-SUUHJWNJSA-N |
| XLogP | 4.23 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|