C26H37NO5S2 — CID 25426136
[2-[(8S,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] morpholine-4-carbodithioate (PubChem CID 25426136) has the molecular formula C26H37NO5S2 and a molecular weight of 507.72 g/mol. Its IUPAC name is [2-[(8S,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] morpholine-4-carbodithioate.
| Compound Name | [2-[(8S,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] morpholine-4-carbodithioate |
|---|---|
| PubChem CID | 25426136 |
| Molecular Formula | C26H37NO5S2 |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | [2-[(8S,9S,10R,11R,13S,14S,17R)-11,17-dihydroxy-10,13-dimethyl-3-oxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] morpholine-4-carbodithioate |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2[C@H](O)C[C@@]2(C)[C@H]1CC[C@]2(O)C(=O)CSC(=S)N1CCOCC1 |
| InChI | InChI=1S/C26H37NO5S2/c1-24-7-5-17(28)13-16(24)3-4-18-19-6-8-26(31,25(19,2)14-20(29)22(18)24)21(30)15-34-23(33)27-9-11-32-12-10-27/h13,18-20,22,29,31H,3-12,14-15H2,1-2H3/t18-,19-,20+,22+,24-,25-,26-/m0/s1 |
| InChIKey | GMQFYOHBEHRUEM-XMVLPLKWSA-N |
| XLogP | 3.14 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|