C27H41N3O4 — CID 25424787
2-[(E)-[(8S,9R,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-[(3R)-2-oxoazepan-3-yl]acetamide (PubChem CID 25424787) has the molecular formula C27H41N3O4 and a molecular weight of 471.64 g/mol. Its IUPAC name is 2-[(E)-[(8S,9R,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-[(3R)-2-oxoazepan-3-yl]acetamide.
| Compound Name | 2-[(E)-[(8S,9R,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-[(3R)-2-oxoazepan-3-yl]acetamide |
|---|---|
| PubChem CID | 25424787 |
| Molecular Formula | C27H41N3O4 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | 2-[(E)-[(8S,9R,10R,13S,14S,17R)-17-hydroxy-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ylidene]amino]oxy-N-[(3R)-2-oxoazepan-3-yl]acetamide |
| SMILES | C[C@]12CC[C@@H]3[C@H](CCC4=C/C(=N/OCC(=O)N[C@@H]5CCCCNC5=O)CC[C@@]43C)[C@@H]1CC[C@H]2O |
| InChI | InChI=1S/C27H41N3O4/c1-26-12-10-18(30-34-16-24(32)29-22-5-3-4-14-28-25(22)33)15-17(26)6-7-19-20-8-9-23(31)27(20,2)13-11-21(19)26/h15,19-23,31H,3-14,16H2,1-2H3,(H,28,33)(H,29,32)/b30-18+/t19-,20+,21-,22-,23-,26+,27+/m1/s1 |
| InChIKey | CXHGWWJVUPMWKJ-HZKRJASLSA-N |
| XLogP | 3.47 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|