About 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid
2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 2544) has the molecular formula C10H14O5
and a molecular weight of 214.22 g/mol. Its IUPAC name is 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
Analyze 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
The IUPAC name of 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid (CID 2544) is 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
What is the SMILES notation for 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
The canonical SMILES for 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid is CC1(C(=O)O)C2CCC(O2)C1(C)C(=O)O.
What is the InChIKey of 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
The InChIKey is NMTNUQBORQILRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O5/c1-9(7(11)12)5-3-4-6(15-5)10(9,2)8(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14).
What are the key properties of 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid has a molecular weight of 214.22 g/mol, XLogP of 0.73, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid is sourced from PubChem (CID 2544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).