C8H8Na2O5 — CID 8519
disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 8519) has the molecular formula C8H8Na2O5 and a molecular weight of 230.13 g/mol. Its IUPAC name is disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 8519 |
| Molecular Formula | C8H8Na2O5 |
| Molecular Weight | 230.13 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | disodium;7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | O=C([O-])C1C2CCC(O2)C1C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C8H10O5.2Na/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12;;/h3-6H,1-2H2,(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | XRHVZWWRFMCBAZ-UHFFFAOYSA-L |
| XLogP | -8.71 |
| TPSA | 89.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.13 |
| LogP ≤ 5 | -8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |