C8H10O5 — CID 3225
7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 3225) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
| Compound Name | 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 3225 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| SMILES | O=C(O)C1C2CCC(O2)C1C(=O)O |
| InChI | InChI=1S/C8H10O5/c9-7(10)5-3-1-2-4(13-3)6(5)8(11)12/h3-6H,1-2H2,(H,9,10)(H,11,12) |
| InChIKey | GXEKYRXVRROBEV-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |