C26H21N3O6 — CID 25442262
(3S)-N-[2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 25442262) has the molecular formula C26H21N3O6 and a molecular weight of 471.47 g/mol. Its IUPAC name is (3S)-N-[2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3S)-N-[2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 25442262 |
| Molecular Formula | C26H21N3O6 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | (3S)-N-[2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetyl]-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)NC(=O)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C26H21N3O6/c30-22(27-23(31)21-16-34-19-13-7-8-14-20(19)35-21)15-29-24(32)26(28-25(29)33,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-14,21H,15-16H2,(H,28,33)(H,27,30,31)/t21-/m0/s1 |
| InChIKey | FAHIBVWPJACITH-NRFANRHFSA-N |
| XLogP | 1.96 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|