C24H19N3O5 — CID 40860589
(3R)-N-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 40860589) has the molecular formula C24H19N3O5 and a molecular weight of 429.43 g/mol. Its IUPAC name is (3R)-N-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | (3R)-N-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 40860589 |
| Molecular Formula | C24H19N3O5 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (3R)-N-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | O=C(NN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C24H19N3O5/c28-21(20-15-31-18-13-7-8-14-19(18)32-20)26-27-22(29)24(25-23(27)30,16-9-3-1-4-10-16)17-11-5-2-6-12-17/h1-14,20H,15H2,(H,25,30)(H,26,28)/t20-/m1/s1 |
| InChIKey | JNXJTOZGCCOKKL-HXUWFJFHSA-N |
| XLogP | 2.35 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|