C19H22BrFN2O4S — CID 25443427
2-(4-bromo-2-fluorophenoxy)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide (PubChem CID 25443427) has the molecular formula C19H22BrFN2O4S and a molecular weight of 473.36 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenoxy)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide.
| Compound Name | 2-(4-bromo-2-fluorophenoxy)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide |
|---|---|
| PubChem CID | 25443427 |
| Molecular Formula | C19H22BrFN2O4S |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 2-(4-bromo-2-fluorophenoxy)-N-[3-(diethylsulfamoyl)-4-methylphenyl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)COc2ccc(Br)cc2F)ccc1C |
| InChI | InChI=1S/C19H22BrFN2O4S/c1-4-23(5-2)28(25,26)18-11-15(8-6-13(18)3)22-19(24)12-27-17-9-7-14(20)10-16(17)21/h6-11H,4-5,12H2,1-3H3,(H,22,24) |
| InChIKey | ZWOKVICIZXXSHQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |