C23H30N2O5S — CID 55308081
N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[4-(3-oxobutyl)phenoxy]acetamide (PubChem CID 55308081) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[4-(3-oxobutyl)phenoxy]acetamide.
| Compound Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[4-(3-oxobutyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 55308081 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | N-[3-(diethylsulfamoyl)-4-methylphenyl]-2-[4-(3-oxobutyl)phenoxy]acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1cc(NC(=O)COc2ccc(CCC(C)=O)cc2)ccc1C |
| InChI | InChI=1S/C23H30N2O5S/c1-5-25(6-2)31(28,29)22-15-20(12-7-17(22)3)24-23(27)16-30-21-13-10-19(11-14-21)9-8-18(4)26/h7,10-15H,5-6,8-9,16H2,1-4H3,(H,24,27) |
| InChIKey | LXCSVAOFHNYFCC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |