C21H31FN2O2 — CID 25452506
2-(4-fluorophenoxy)-1-[(3R)-3-[1-(2-methylpropyl)piperidin-4-yl]pyrrolidin-1-yl]ethanone (PubChem CID 25452506) has the molecular formula C21H31FN2O2 and a molecular weight of 362.49 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-1-[(3R)-3-[1-(2-methylpropyl)piperidin-4-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenoxy)-1-[(3R)-3-[1-(2-methylpropyl)piperidin-4-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 25452506 |
| Molecular Formula | C21H31FN2O2 |
| Molecular Weight | 362.49 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 2-(4-fluorophenoxy)-1-[(3R)-3-[1-(2-methylpropyl)piperidin-4-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CC(C)CN1CCC([C@H]2CCN(C(=O)COc3ccc(F)cc3)C2)CC1 |
| InChI | InChI=1S/C21H31FN2O2/c1-16(2)13-23-10-7-17(8-11-23)18-9-12-24(14-18)21(25)15-26-20-5-3-19(22)4-6-20/h3-6,16-18H,7-15H2,1-2H3/t18-/m0/s1 |
| InChIKey | KICQXZWEMUUAOV-SFHVURJKSA-N |
| XLogP | 3.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |