C24H23N3O — CID 25453502
(1S,5S,7S)-3-phenyl-7-quinolin-8-yl-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one (PubChem CID 25453502) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is (1S,5S,7S)-3-phenyl-7-quinolin-8-yl-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one.
| Compound Name | (1S,5S,7S)-3-phenyl-7-quinolin-8-yl-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
|---|---|
| PubChem CID | 25453502 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (1S,5S,7S)-3-phenyl-7-quinolin-8-yl-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
| SMILES | O=C1N(c2ccccc2)C[C@@H]2C[C@@H](c3cccc4cccnc34)N3CCC[C@@]123 |
| InChI | InChI=1S/C24H23N3O/c28-23-24-12-6-14-27(24)21(20-11-4-7-17-8-5-13-25-22(17)20)15-18(24)16-26(23)19-9-2-1-3-10-19/h1-5,7-11,13,18,21H,6,12,14-16H2/t18-,21-,24-/m0/s1 |
| InChIKey | BUDMBTAMPZEXKH-XZOYJPPVSA-N |
| XLogP | 4.18 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |