C22H30N2O3 — CID 25458584
(1S,5S,7S)-3-cyclopentyl-7-(3,5-dimethoxyphenyl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one (PubChem CID 25458584) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is (1S,5S,7S)-3-cyclopentyl-7-(3,5-dimethoxyphenyl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one.
| Compound Name | (1S,5S,7S)-3-cyclopentyl-7-(3,5-dimethoxyphenyl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
|---|---|
| PubChem CID | 25458584 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | (1S,5S,7S)-3-cyclopentyl-7-(3,5-dimethoxyphenyl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
| SMILES | COc1cc(OC)cc([C@@H]2C[C@H]3CN(C4CCCC4)C(=O)[C@]34CCCN24)c1 |
| InChI | InChI=1S/C22H30N2O3/c1-26-18-10-15(11-19(13-18)27-2)20-12-16-14-23(17-6-3-4-7-17)21(25)22(16)8-5-9-24(20)22/h10-11,13,16-17,20H,3-9,12,14H2,1-2H3/t16-,20-,22-/m0/s1 |
| InChIKey | OAPBELGWDIMUOF-BUKVSMQUSA-N |
| XLogP | 3.38 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |