C14H15N3O5 — CID 25465841
methyl 4-[3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoylamino]benzoate (PubChem CID 25465841) has the molecular formula C14H15N3O5 and a molecular weight of 305.29 g/mol. Its IUPAC name is methyl 4-[3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoylamino]benzoate.
| Compound Name | methyl 4-[3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 25465841 |
| Molecular Formula | C14H15N3O5 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | methyl 4-[3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)CC[C@@H]2NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C14H15N3O5/c1-22-13(20)8-2-4-9(5-3-8)15-11(18)7-6-10-12(19)17-14(21)16-10/h2-5,10H,6-7H2,1H3,(H,15,18)(H2,16,17,19,21)/t10-/m0/s1 |
| InChIKey | AKFATPOJDQRWON-JTQLQIEISA-N |
| XLogP | 0.40 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|