C29H30N4O2 — CID 25470117
(3R)-3-acetamido-N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-3-(4-methylphenyl)propanamide (PubChem CID 25470117) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is (3R)-3-acetamido-N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-3-(4-methylphenyl)propanamide.
| Compound Name | (3R)-3-acetamido-N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-3-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 25470117 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (3R)-3-acetamido-N-[(1-benzyl-3-phenylpyrazol-4-yl)methyl]-3-(4-methylphenyl)propanamide |
| SMILES | CC(=O)N[C@H](CC(=O)NCc1cn(Cc2ccccc2)nc1-c1ccccc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H30N4O2/c1-21-13-15-24(16-14-21)27(31-22(2)34)17-28(35)30-18-26-20-33(19-23-9-5-3-6-10-23)32-29(26)25-11-7-4-8-12-25/h3-16,20,27H,17-19H2,1-2H3,(H,30,35)(H,31,34)/t27-/m1/s1 |
| InChIKey | IWTRUTKKGGHCEE-HHHXNRCGSA-N |
| XLogP | 4.79 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |