C15H16N4OS — CID 25476105
1-(6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)piperidin-4-ol (PubChem CID 25476105) has the molecular formula C15H16N4OS and a molecular weight of 300.39 g/mol. Its IUPAC name is 1-(6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)piperidin-4-ol.
| Compound Name | 1-(6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 25476105 |
| Molecular Formula | C15H16N4OS |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | 1-(6-phenylimidazo[2,1-b][1,3,4]thiadiazol-2-yl)piperidin-4-ol |
| SMILES | OC1CCN(c2nn3cc(-c4ccccc4)nc3s2)CC1 |
| InChI | InChI=1S/C15H16N4OS/c20-12-6-8-18(9-7-12)15-17-19-10-13(16-14(19)21-15)11-4-2-1-3-5-11/h1-5,10,12,20H,6-9H2 |
| InChIKey | ZWXLJEWUKHLXHE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 53.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |