C21H25FN2O3S — CID 25479687
2-(N-(2-fluorophenyl)sulfonylanilino)-N-[(1R,2R)-2-methylcyclohexyl]acetamide (PubChem CID 25479687) has the molecular formula C21H25FN2O3S and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-(N-(2-fluorophenyl)sulfonylanilino)-N-[(1R,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-(N-(2-fluorophenyl)sulfonylanilino)-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 25479687 |
| Molecular Formula | C21H25FN2O3S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | 2-(N-(2-fluorophenyl)sulfonylanilino)-N-[(1R,2R)-2-methylcyclohexyl]acetamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)CN(c1ccccc1)S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C21H25FN2O3S/c1-16-9-5-7-13-19(16)23-21(25)15-24(17-10-3-2-4-11-17)28(26,27)20-14-8-6-12-18(20)22/h2-4,6,8,10-12,14,16,19H,5,7,9,13,15H2,1H3,(H,23,25)/t16-,19-/m1/s1 |
| InChIKey | NDANFQFJMBMVPJ-VQIMIIECSA-N |
| XLogP | 3.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |