C18H24ClN5OS — CID 25482533
(2R)-4-[(2-chlorophenyl)methyl]-2-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]morpholine (PubChem CID 25482533) has the molecular formula C18H24ClN5OS and a molecular weight of 393.94 g/mol. Its IUPAC name is (2R)-4-[(2-chlorophenyl)methyl]-2-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]morpholine.
| Compound Name | (2R)-4-[(2-chlorophenyl)methyl]-2-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]morpholine |
|---|---|
| PubChem CID | 25482533 |
| Molecular Formula | C18H24ClN5OS |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | (2R)-4-[(2-chlorophenyl)methyl]-2-[(1-cyclopentyltetrazol-5-yl)sulfanylmethyl]morpholine |
| SMILES | Clc1ccccc1CN1CCO[C@@H](CSc2nnnn2C2CCCC2)C1 |
| InChI | InChI=1S/C18H24ClN5OS/c19-17-8-4-1-5-14(17)11-23-9-10-25-16(12-23)13-26-18-20-21-22-24(18)15-6-2-3-7-15/h1,4-5,8,15-16H,2-3,6-7,9-13H2/t16-/m1/s1 |
| InChIKey | ILARJNBSMDKXNK-MRXNPFEDSA-N |
| XLogP | 3.43 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |