C29H31FN6O3 — CID 2552453
(E)-N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide (PubChem CID 2552453) has the molecular formula C29H31FN6O3 and a molecular weight of 530.60 g/mol. Its IUPAC name is (E)-N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 2552453 |
| Molecular Formula | C29H31FN6O3 |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | (E)-N-(6-amino-2,4-dioxo-1-propylpyrimidin-5-yl)-N-butyl-3-[3-(4-fluorophenyl)-1-phenylpyrazol-4-yl]prop-2-enamide |
| SMILES | CCCCN(C(=O)/C=C/c1cn(-c2ccccc2)nc1-c1ccc(F)cc1)c1c(N)n(CCC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C29H31FN6O3/c1-3-5-18-34(26-27(31)35(17-4-2)29(39)32-28(26)38)24(37)16-13-21-19-36(23-9-7-6-8-10-23)33-25(21)20-11-14-22(30)15-12-20/h6-16,19H,3-5,17-18,31H2,1-2H3,(H,32,38,39)/b16-13+ |
| InChIKey | OYJXSXBUNPRLNR-DTQAZKPQSA-N |
| XLogP | 4.37 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|