C18H18Cl2N2O2S — CID 2554994
(E)-N-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-propyl-3-thiophen-2-ylprop-2-enamide (PubChem CID 2554994) has the molecular formula C18H18Cl2N2O2S and a molecular weight of 397.33 g/mol. Its IUPAC name is (E)-N-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-propyl-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-propyl-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 2554994 |
| Molecular Formula | C18H18Cl2N2O2S |
| Molecular Weight | 397.33 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | (E)-N-[2-(2,5-dichloroanilino)-2-oxoethyl]-N-propyl-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCCN(CC(=O)Nc1cc(Cl)ccc1Cl)C(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C18H18Cl2N2O2S/c1-2-9-22(18(24)8-6-14-4-3-10-25-14)12-17(23)21-16-11-13(19)5-7-15(16)20/h3-8,10-11H,2,9,12H2,1H3,(H,21,23)/b8-6+ |
| InChIKey | HWVSMKHQAIKOOW-SOFGYWHQSA-N |
| XLogP | 4.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.33 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|