C14H17NO6 — CID 2559094
2-O-ethyl 4-O-[(3R)-2-oxooxolan-3-yl] 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 2559094) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-O-ethyl 4-O-[(3R)-2-oxooxolan-3-yl] 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-[(3R)-2-oxooxolan-3-yl] 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 2559094 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-O-ethyl 4-O-[(3R)-2-oxooxolan-3-yl] 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(=O)O[C@@H]2CCOC2=O)c1C |
| InChI | InChI=1S/C14H17NO6/c1-4-19-14(18)11-7(2)10(8(3)15-11)13(17)21-9-5-6-20-12(9)16/h9,15H,4-6H2,1-3H3/t9-/m1/s1 |
| InChIKey | OVVSGURBOWGIRB-SECBINFHSA-N |
| XLogP | 1.28 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|