C15H19NO6 — CID 41236498
2-O-ethyl 4-O-[(3R,5R)-5-methyl-2-oxooxolan-3-yl] 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 41236498) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-O-ethyl 4-O-[(3R,5R)-5-methyl-2-oxooxolan-3-yl] 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 2-O-ethyl 4-O-[(3R,5R)-5-methyl-2-oxooxolan-3-yl] 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 41236498 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-O-ethyl 4-O-[(3R,5R)-5-methyl-2-oxooxolan-3-yl] 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]c(C)c(C(=O)O[C@@H]2C[C@@H](C)OC2=O)c1C |
| InChI | InChI=1S/C15H19NO6/c1-5-20-15(19)12-8(3)11(9(4)16-12)14(18)22-10-6-7(2)21-13(10)17/h7,10,16H,5-6H2,1-4H3/t7-,10-/m1/s1 |
| InChIKey | UGEPDDYVBSXORE-GMSGAONNSA-N |
| XLogP | 1.67 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|