C16H21NO6 — CID 75401925
2-O-(5-methyl-2-oxooxolan-3-yl) 4-O-propan-2-yl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 75401925) has the molecular formula C16H21NO6 and a molecular weight of 323.35 g/mol. Its IUPAC name is 2-O-(5-methyl-2-oxooxolan-3-yl) 4-O-propan-2-yl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 2-O-(5-methyl-2-oxooxolan-3-yl) 4-O-propan-2-yl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 75401925 |
| Molecular Formula | C16H21NO6 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 2-O-(5-methyl-2-oxooxolan-3-yl) 4-O-propan-2-yl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | Cc1[nH]c(C(=O)OC2CC(C)OC2=O)c(C)c1C(=O)OC(C)C |
| InChI | InChI=1S/C16H21NO6/c1-7(2)21-15(19)12-9(4)13(17-10(12)5)16(20)23-11-6-8(3)22-14(11)18/h7-8,11,17H,6H2,1-5H3 |
| InChIKey | WTXPWIYVDBNRFB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|