C21H22ClN2O2S+ — CID 2560224
[(2S)-2-(benzenesulfonamido)-2-phenylethyl]-[(4-chlorophenyl)methyl]azanium (PubChem CID 2560224) has the molecular formula C21H22ClN2O2S+ and a molecular weight of 401.94 g/mol. Its IUPAC name is [(2S)-2-(benzenesulfonamido)-2-phenylethyl]-[(4-chlorophenyl)methyl]azanium.
| Compound Name | [(2S)-2-(benzenesulfonamido)-2-phenylethyl]-[(4-chlorophenyl)methyl]azanium |
|---|---|
| PubChem CID | 2560224 |
| Molecular Formula | C21H22ClN2O2S+ |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [(2S)-2-(benzenesulfonamido)-2-phenylethyl]-[(4-chlorophenyl)methyl]azanium |
| SMILES | O=S(=O)(N[C@H](C[NH2+]Cc1ccc(Cl)cc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H21ClN2O2S/c22-19-13-11-17(12-14-19)15-23-16-21(18-7-3-1-4-8-18)24-27(25,26)20-9-5-2-6-10-20/h1-14,21,23-24H,15-16H2/p+1/t21-/m1/s1 |
| InChIKey | UUSFCAKNJJYTTN-OAQYLSRUSA-O |
| XLogP | 3.12 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |