About 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine
4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine (PubChem CID 2564250) has the molecular formula C19H17N3O4S3
and a molecular weight of 447.56 g/mol. Its IUPAC name is 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine.
Molecular Properties
| Compound Name | 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine |
| PubChem CID | 2564250 |
| Molecular Formula | C19H17N3O4S3 |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.04 |
| IUPAC Name | 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine |
| SMILES | Cc1nc2c(cc(Oc3ccc(S(=O)(=O)N4CCOCC4)cn3)c3ccsc32)s1 |
| InChI | InChI=1S/C19H17N3O4S3/c1-12-21-18-16(28-12)10-15(14-4-9-27-19(14)18)26-17-3-2-13(11-20-17)29(23,24)22-5-7-25-8-6-22/h2-4,9-11H,5-8H2,1H3 |
| InChIKey | MPSXPWMJSXBEON-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine?
The IUPAC name of 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine (CID 2564250) is 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine.
What is the SMILES notation for 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine?
The canonical SMILES for 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine is Cc1nc2c(cc(Oc3ccc(S(=O)(=O)N4CCOCC4)cn3)c3ccsc32)s1.
What is the InChIKey of 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine?
The InChIKey is MPSXPWMJSXBEON-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O4S3/c1-12-21-18-16(28-12)10-15(14-4-9-27-19(14)18)26-17-3-2-13(11-20-17)29(23,24)22-5-7-25-8-6-22/h2-4,9-11H,5-8H2,1H3.
What are the key properties of 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine?
4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine has a molecular weight of 447.56 g/mol, XLogP of 4.03, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[6-(2-methylthieno[2,3-e][1,3]benzothiazol-5-yl)oxy-3-pyridinyl]sulfonyl]morpholine is sourced from PubChem (CID 2564250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).