C16H14ClN3O4S2 — CID 2378003
4-(3-chloro-4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)sulfonylmorpholine (PubChem CID 2378003) has the molecular formula C16H14ClN3O4S2 and a molecular weight of 411.89 g/mol. Its IUPAC name is 4-(3-chloro-4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)sulfonylmorpholine.
| Compound Name | 4-(3-chloro-4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)sulfonylmorpholine |
|---|---|
| PubChem CID | 2378003 |
| Molecular Formula | C16H14ClN3O4S2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 4-(3-chloro-4-thieno[2,3-d]pyrimidin-4-yloxyphenyl)sulfonylmorpholine |
| SMILES | O=S(=O)(c1ccc(Oc2ncnc3sccc23)c(Cl)c1)N1CCOCC1 |
| InChI | InChI=1S/C16H14ClN3O4S2/c17-13-9-11(26(21,22)20-4-6-23-7-5-20)1-2-14(13)24-15-12-3-8-25-16(12)19-10-18-15/h1-3,8-10H,4-7H2 |
| InChIKey | GWWDKWSOKDWNHU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |