C23H36N4OS — CID 2578192
(2R)-2-[[5-(4-tert-butylphenyl)-4-[(2R)-2-methylheptyl]-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 2578192) has the molecular formula C23H36N4OS and a molecular weight of 416.64 g/mol. Its IUPAC name is (2R)-2-[[5-(4-tert-butylphenyl)-4-[(2R)-2-methylheptyl]-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2R)-2-[[5-(4-tert-butylphenyl)-4-[(2R)-2-methylheptyl]-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 2578192 |
| Molecular Formula | C23H36N4OS |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | (2R)-2-[[5-(4-tert-butylphenyl)-4-[(2R)-2-methylheptyl]-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | CCCCC[C@@H](C)Cn1c(S[C@H](C)C(N)=O)nnc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H36N4OS/c1-7-8-9-10-16(2)15-27-21(25-26-22(27)29-17(3)20(24)28)18-11-13-19(14-12-18)23(4,5)6/h11-14,16-17H,7-10,15H2,1-6H3,(H2,24,28)/t16-,17-/m1/s1 |
| InChIKey | BAYRVLYAYLHVHU-IAGOWNOFSA-N |
| XLogP | 5.42 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|