C20H27ClN8S — CID 41096681
6-[[5-(4-chlorophenyl)-4-[(2S)-2-methylheptyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 41096681) has the molecular formula C20H27ClN8S and a molecular weight of 447.01 g/mol. Its IUPAC name is 6-[[5-(4-chlorophenyl)-4-[(2S)-2-methylheptyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[[5-(4-chlorophenyl)-4-[(2S)-2-methylheptyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 41096681 |
| Molecular Formula | C20H27ClN8S |
| Molecular Weight | 447.01 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 6-[[5-(4-chlorophenyl)-4-[(2S)-2-methylheptyl]-1,2,4-triazol-3-yl]sulfanylmethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCC[C@H](C)Cn1c(SCc2nc(N)nc(N)n2)nnc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H27ClN8S/c1-3-4-5-6-13(2)11-29-17(14-7-9-15(21)10-8-14)27-28-20(29)30-12-16-24-18(22)26-19(23)25-16/h7-10,13H,3-6,11-12H2,1-2H3,(H4,22,23,24,25,26)/t13-/m0/s1 |
| InChIKey | MTMAPQXWJYYUPZ-ZDUSSCGKSA-N |
| XLogP | 4.46 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.01 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|