C25H21N3O4S — CID 2579481
4-[(E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoyl]-1,3-dihydroquinoxalin-2-one (PubChem CID 2579481) has the molecular formula C25H21N3O4S and a molecular weight of 459.53 g/mol. Its IUPAC name is 4-[(E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoyl]-1,3-dihydroquinoxalin-2-one.
| Compound Name | 4-[(E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoyl]-1,3-dihydroquinoxalin-2-one |
|---|---|
| PubChem CID | 2579481 |
| Molecular Formula | C25H21N3O4S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 4-[(E)-3-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]prop-2-enoyl]-1,3-dihydroquinoxalin-2-one |
| SMILES | O=C1CN(C(=O)/C=C/c2ccc(S(=O)(=O)N3CCc4ccccc43)cc2)c2ccccc2N1 |
| InChI | InChI=1S/C25H21N3O4S/c29-24-17-27(23-8-4-2-6-21(23)26-24)25(30)14-11-18-9-12-20(13-10-18)33(31,32)28-16-15-19-5-1-3-7-22(19)28/h1-14H,15-17H2,(H,26,29)/b14-11+ |
| InChIKey | XGMPVGQRLUMROM-SDNWHVSQSA-N |
| XLogP | 3.44 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|