C20H31N2O3S+ — CID 2579925
4-methylsulfonyl-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]benzamide (PubChem CID 2579925) has the molecular formula C20H31N2O3S+ and a molecular weight of 379.55 g/mol. Its IUPAC name is 4-methylsulfonyl-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]benzamide.
| Compound Name | 4-methylsulfonyl-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 2579925 |
| Molecular Formula | C20H31N2O3S+ |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 4-methylsulfonyl-N-[(1-piperidin-1-ium-1-ylcyclohexyl)methyl]benzamide |
| SMILES | CS(=O)(=O)c1ccc(C(=O)NCC2([NH+]3CCCCC3)CCCCC2)cc1 |
| InChI | InChI=1S/C20H30N2O3S/c1-26(24,25)18-10-8-17(9-11-18)19(23)21-16-20(12-4-2-5-13-20)22-14-6-3-7-15-22/h8-11H,2-7,12-16H2,1H3,(H,21,23)/p+1 |
| InChIKey | FBYNCHKAXDIAET-UHFFFAOYSA-O |
| XLogP | 1.59 |
| TPSA | 67.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |