C18H21N3O4 — CID 2583395
2-[2-[(4S)-4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]ethyl]isoindole-1,3-dione (PubChem CID 2583395) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[2-[(4S)-4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(4S)-4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 2583395 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[2-[(4S)-4-methyl-4-(2-methylpropyl)-2,5-dioxoimidazolidin-1-yl]ethyl]isoindole-1,3-dione |
| SMILES | CC(C)C[C@]1(C)NC(=O)N(CCN2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C18H21N3O4/c1-11(2)10-18(3)16(24)21(17(25)19-18)9-8-20-14(22)12-6-4-5-7-13(12)15(20)23/h4-7,11H,8-10H2,1-3H3,(H,19,25)/t18-/m0/s1 |
| InChIKey | HKYXFMVDDOUPKM-SFHVURJKSA-N |
| XLogP | 1.64 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|