C18H25N3O4S — CID 2588973
N'-(cyclohepten-1-yl)-3-morpholin-4-ylsulfonylbenzohydrazide (PubChem CID 2588973) has the molecular formula C18H25N3O4S and a molecular weight of 379.48 g/mol. Its IUPAC name is N'-(cyclohepten-1-yl)-3-morpholin-4-ylsulfonylbenzohydrazide.
| Compound Name | N'-(cyclohepten-1-yl)-3-morpholin-4-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 2588973 |
| Molecular Formula | C18H25N3O4S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N'-(cyclohepten-1-yl)-3-morpholin-4-ylsulfonylbenzohydrazide |
| SMILES | O=C(NNC1=CCCCCC1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H25N3O4S/c22-18(20-19-16-7-3-1-2-4-8-16)15-6-5-9-17(14-15)26(23,24)21-10-12-25-13-11-21/h5-7,9,14,19H,1-4,8,10-13H2,(H,20,22) |
| InChIKey | WVKLRWAHEOJCOD-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|