C24H17FN2O5 — CID 2599918
[(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 3-(1,3-dioxoisoindol-2-yl)benzoate (PubChem CID 2599918) has the molecular formula C24H17FN2O5 and a molecular weight of 432.41 g/mol. Its IUPAC name is [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 3-(1,3-dioxoisoindol-2-yl)benzoate.
| Compound Name | [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 2599918 |
| Molecular Formula | C24H17FN2O5 |
| Molecular Weight | 432.41 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | [(2S)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 3-(1,3-dioxoisoindol-2-yl)benzoate |
| SMILES | C[C@H](OC(=O)c1cccc(N2C(=O)c3ccccc3C2=O)c1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C24H17FN2O5/c1-14(21(28)26-20-12-5-4-11-19(20)25)32-24(31)15-7-6-8-16(13-15)27-22(29)17-9-2-3-10-18(17)23(27)30/h2-14H,1H3,(H,26,28)/t14-/m0/s1 |
| InChIKey | XOJZWCAGTDTOND-AWEZNQCLSA-N |
| XLogP | 3.81 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|