C20H28BrN3O2 — CID 26003013
(5S,9S)-3-[[(4-bromophenyl)methyl-methylamino]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 26003013) has the molecular formula C20H28BrN3O2 and a molecular weight of 422.37 g/mol. Its IUPAC name is (5S,9S)-3-[[(4-bromophenyl)methyl-methylamino]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | (5S,9S)-3-[[(4-bromophenyl)methyl-methylamino]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26003013 |
| Molecular Formula | C20H28BrN3O2 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | (5S,9S)-3-[[(4-bromophenyl)methyl-methylamino]methyl]-7,7,9-trimethyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | C[C@H]1CC(C)(C)C[C@]2(C1)NC(=O)N(CN(C)Cc1ccc(Br)cc1)C2=O |
| InChI | InChI=1S/C20H28BrN3O2/c1-14-9-19(2,3)12-20(10-14)17(25)24(18(26)22-20)13-23(4)11-15-5-7-16(21)8-6-15/h5-8,14H,9-13H2,1-4H3,(H,22,26)/t14-,20-/m0/s1 |
| InChIKey | WKTZBOCWWWNZGW-XOBRGWDASA-N |
| XLogP | 3.98 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|