C20H24N4O4S — CID 26017530
3-[4-(diethylsulfamoyl)phenyl]-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanamide (PubChem CID 26017530) has the molecular formula C20H24N4O4S and a molecular weight of 416.50 g/mol. Its IUPAC name is 3-[4-(diethylsulfamoyl)phenyl]-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanamide.
| Compound Name | 3-[4-(diethylsulfamoyl)phenyl]-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanamide |
|---|---|
| PubChem CID | 26017530 |
| Molecular Formula | C20H24N4O4S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 3-[4-(diethylsulfamoyl)phenyl]-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(CCC(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C20H24N4O4S/c1-3-24(4-2)29(27,28)16-9-5-14(6-10-16)7-12-19(25)21-15-8-11-17-18(13-15)23-20(26)22-17/h5-6,8-11,13H,3-4,7,12H2,1-2H3,(H,21,25)(H2,22,23,26) |
| InChIKey | JHSRBKZZDCPHLW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |