C18H19FN4O4S — CID 26700730
5-(diethylsulfamoyl)-2-fluoro-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide (PubChem CID 26700730) has the molecular formula C18H19FN4O4S and a molecular weight of 406.44 g/mol. Its IUPAC name is 5-(diethylsulfamoyl)-2-fluoro-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide.
| Compound Name | 5-(diethylsulfamoyl)-2-fluoro-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide |
|---|---|
| PubChem CID | 26700730 |
| Molecular Formula | C18H19FN4O4S |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 5-(diethylsulfamoyl)-2-fluoro-N-(2-oxo-1,3-dihydrobenzimidazol-5-yl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(F)c(C(=O)Nc2ccc3[nH]c(=O)[nH]c3c2)c1 |
| InChI | InChI=1S/C18H19FN4O4S/c1-3-23(4-2)28(26,27)12-6-7-14(19)13(10-12)17(24)20-11-5-8-15-16(9-11)22-18(25)21-15/h5-10H,3-4H2,1-2H3,(H,20,24)(H2,21,22,25) |
| InChIKey | QPPAXPUSXFTKQF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |