C15H14N2S3 — CID 26031352
3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-1,3-benzothiazole-2-thione (PubChem CID 26031352) has the molecular formula C15H14N2S3 and a molecular weight of 318.49 g/mol. Its IUPAC name is 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-1,3-benzothiazole-2-thione.
| Compound Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-1,3-benzothiazole-2-thione |
|---|---|
| PubChem CID | 26031352 |
| Molecular Formula | C15H14N2S3 |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-ylmethyl)-1,3-benzothiazole-2-thione |
| SMILES | S=c1sc2ccccc2n1CN1CCc2sccc2C1 |
| InChI | InChI=1S/C15H14N2S3/c18-15-17(12-3-1-2-4-14(12)20-15)10-16-7-5-13-11(9-16)6-8-19-13/h1-4,6,8H,5,7,9-10H2 |
| InChIKey | RYVAHHCVJVPFDR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|