C19H18N2O3S — CID 2604276
(E)-N-(1,3-benzothiazol-2-yl)-3-(furan-2-yl)-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide (PubChem CID 2604276) has the molecular formula C19H18N2O3S and a molecular weight of 354.43 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-yl)-3-(furan-2-yl)-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-yl)-3-(furan-2-yl)-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 2604276 |
| Molecular Formula | C19H18N2O3S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-yl)-3-(furan-2-yl)-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)N(C[C@H]1CCCO1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C19H18N2O3S/c22-18(10-9-14-5-3-11-23-14)21(13-15-6-4-12-24-15)19-20-16-7-1-2-8-17(16)25-19/h1-3,5,7-11,15H,4,6,12-13H2/b10-9+/t15-/m1/s1 |
| InChIKey | YVEHQVNGHMOPBZ-BOLDSZDNSA-N |
| XLogP | 4.11 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|