C24H25N3O4S2 — CID 55538530
(E)-N-(1,3-benzothiazol-2-yl)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 55538530) has the molecular formula C24H25N3O4S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is (E)-N-(1,3-benzothiazol-2-yl)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-(1,3-benzothiazol-2-yl)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 55538530 |
| Molecular Formula | C24H25N3O4S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | (E)-N-(1,3-benzothiazol-2-yl)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(N2CCCS2(=O)=O)cc1)N(CC1CCCO1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H25N3O4S2/c28-23(13-10-18-8-11-19(12-9-18)27-14-4-16-33(27,29)30)26(17-20-5-3-15-31-20)24-25-21-6-1-2-7-22(21)32-24/h1-2,6-13,20H,3-5,14-17H2/b13-10+ |
| InChIKey | FRAIGEACOYQJRE-JLHYYAGUSA-N |
| XLogP | 4.06 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|