C22H21N3O4S2 — CID 44948392
(E)-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 44948392) has the molecular formula C22H21N3O4S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is (E)-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 44948392 |
| Molecular Formula | C22H21N3O4S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | (E)-N-(4-methylsulfanyl-1,3-benzothiazol-2-yl)-3-(3-nitrophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | CSc1cccc2sc(N(CC3CCCO3)C(=O)/C=C/c3cccc([N+](=O)[O-])c3)nc12 |
| InChI | InChI=1S/C22H21N3O4S2/c1-30-18-8-3-9-19-21(18)23-22(31-19)24(14-17-7-4-12-29-17)20(26)11-10-15-5-2-6-16(13-15)25(27)28/h2-3,5-6,8-11,13,17H,4,7,12,14H2,1H3/b11-10+ |
| InChIKey | OJKJBHWJAHCERN-ZHACJKMWSA-N |
| XLogP | 5.15 |
| TPSA | 85.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|