C18H14N4O4S — CID 26048596
N'-(furan-2-carbonyl)-3-methyl-6-(5-methylthiophen-2-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide (PubChem CID 26048596) has the molecular formula C18H14N4O4S and a molecular weight of 382.40 g/mol. Its IUPAC name is N'-(furan-2-carbonyl)-3-methyl-6-(5-methylthiophen-2-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide.
| Compound Name | N'-(furan-2-carbonyl)-3-methyl-6-(5-methylthiophen-2-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 26048596 |
| Molecular Formula | C18H14N4O4S |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N'-(furan-2-carbonyl)-3-methyl-6-(5-methylthiophen-2-yl)-[1,2]oxazolo[5,4-b]pyridine-4-carbohydrazide |
| SMILES | Cc1ccc(-c2cc(C(=O)NNC(=O)c3ccco3)c3c(C)noc3n2)s1 |
| InChI | InChI=1S/C18H14N4O4S/c1-9-5-6-14(27-9)12-8-11(15-10(2)22-26-18(15)19-12)16(23)20-21-17(24)13-4-3-7-25-13/h3-8H,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | FNYKKZYLUVLVMH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|