C26H26N2O6S — CID 26058020
[2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 5-nitro-2-phenylsulfanylbenzoate (PubChem CID 26058020) has the molecular formula C26H26N2O6S and a molecular weight of 494.57 g/mol. Its IUPAC name is [2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 5-nitro-2-phenylsulfanylbenzoate.
| Compound Name | [2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 5-nitro-2-phenylsulfanylbenzoate |
|---|---|
| PubChem CID | 26058020 |
| Molecular Formula | C26H26N2O6S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [2-[2,5-dimethyl-1-[[(2S)-oxolan-2-yl]methyl]pyrrol-3-yl]-2-oxoethyl] 5-nitro-2-phenylsulfanylbenzoate |
| SMILES | Cc1cc(C(=O)COC(=O)c2cc([N+](=O)[O-])ccc2Sc2ccccc2)c(C)n1C[C@@H]1CCCO1 |
| InChI | InChI=1S/C26H26N2O6S/c1-17-13-22(18(2)27(17)15-20-7-6-12-33-20)24(29)16-34-26(30)23-14-19(28(31)32)10-11-25(23)35-21-8-4-3-5-9-21/h3-5,8-11,13-14,20H,6-7,12,15-16H2,1-2H3/t20-/m0/s1 |
| InChIKey | MDXGSLXTVZZZBX-FQEVSTJZSA-N |
| XLogP | 5.38 |
| TPSA | 100.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|