C18H19NO5S — CID 26061559
[2-oxo-2-(1H-pyrrol-2-yl)ethyl] 1-(benzenesulfonyl)cyclopentane-1-carboxylate (PubChem CID 26061559) has the molecular formula C18H19NO5S and a molecular weight of 361.42 g/mol. Its IUPAC name is [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 1-(benzenesulfonyl)cyclopentane-1-carboxylate.
| Compound Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 1-(benzenesulfonyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 26061559 |
| Molecular Formula | C18H19NO5S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [2-oxo-2-(1H-pyrrol-2-yl)ethyl] 1-(benzenesulfonyl)cyclopentane-1-carboxylate |
| SMILES | O=C(COC(=O)C1(S(=O)(=O)c2ccccc2)CCCC1)c1ccc[nH]1 |
| InChI | InChI=1S/C18H19NO5S/c20-16(15-9-6-12-19-15)13-24-17(21)18(10-4-5-11-18)25(22,23)14-7-2-1-3-8-14/h1-3,6-9,12,19H,4-5,10-11,13H2 |
| InChIKey | MVWJGXYMLKNEGA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |