C26H28N2O3S — CID 26082603
4-(1,3-benzothiazol-2-yl)-1-spiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-ylbutan-1-one (PubChem CID 26082603) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-yl)-1-spiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-ylbutan-1-one.
| Compound Name | 4-(1,3-benzothiazol-2-yl)-1-spiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-ylbutan-1-one |
|---|---|
| PubChem CID | 26082603 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 4-(1,3-benzothiazol-2-yl)-1-spiro[2,3,6,8-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline-9,1'-cyclopentane]-7-ylbutan-1-one |
| SMILES | O=C(CCCc1nc2ccccc2s1)N1Cc2cc3c(cc2C2(CCCC2)C1)OCCO3 |
| InChI | InChI=1S/C26H28N2O3S/c29-25(9-5-8-24-27-20-6-1-2-7-23(20)32-24)28-16-18-14-21-22(31-13-12-30-21)15-19(18)26(17-28)10-3-4-11-26/h1-2,6-7,14-15H,3-5,8-13,16-17H2 |
| InChIKey | NSDSAXRTPZWVCO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |