C18H25N3OS — CID 120808073
1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-5-(1,3-benzothiazol-2-yl)pentan-1-one (PubChem CID 120808073) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-5-(1,3-benzothiazol-2-yl)pentan-1-one.
| Compound Name | 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-5-(1,3-benzothiazol-2-yl)pentan-1-one |
|---|---|
| PubChem CID | 120808073 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-5-(1,3-benzothiazol-2-yl)pentan-1-one |
| SMILES | CC1(CN)CCN(C(=O)CCCCc2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C18H25N3OS/c1-18(12-19)10-11-21(13-18)17(22)9-5-4-8-16-20-14-6-2-3-7-15(14)23-16/h2-3,6-7H,4-5,8-13,19H2,1H3 |
| InChIKey | WVCQHQMIIOLTLN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|