C25H29N3O3 — CID 26084194
(3R)-N-[2-(cyclopentylcarbamoyl)phenyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide (PubChem CID 26084194) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is (3R)-N-[2-(cyclopentylcarbamoyl)phenyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[2-(cyclopentylcarbamoyl)phenyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 26084194 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | (3R)-N-[2-(cyclopentylcarbamoyl)phenyl]-5-oxo-1-(2-phenylethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NC1CCCC1)c1ccccc1NC(=O)[C@@H]1CC(=O)N(CCc2ccccc2)C1 |
| InChI | InChI=1S/C25H29N3O3/c29-23-16-19(17-28(23)15-14-18-8-2-1-3-9-18)24(30)27-22-13-7-6-12-21(22)25(31)26-20-10-4-5-11-20/h1-3,6-9,12-13,19-20H,4-5,10-11,14-17H2,(H,26,31)(H,27,30)/t19-/m1/s1 |
| InChIKey | XACUZPHICHRTDQ-LJQANCHMSA-N |
| XLogP | 3.39 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |