C22H31N3O3 — CID 41066253
(3R)-1-butyl-N-[2-(cyclohexylcarbamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 41066253) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is (3R)-1-butyl-N-[2-(cyclohexylcarbamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-1-butyl-N-[2-(cyclohexylcarbamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 41066253 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (3R)-1-butyl-N-[2-(cyclohexylcarbamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCCCN1C[C@H](C(=O)Nc2ccccc2C(=O)NC2CCCCC2)CC1=O |
| InChI | InChI=1S/C22H31N3O3/c1-2-3-13-25-15-16(14-20(25)26)21(27)24-19-12-8-7-11-18(19)22(28)23-17-9-5-4-6-10-17/h7-8,11-12,16-17H,2-6,9-10,13-15H2,1H3,(H,23,28)(H,24,27)/t16-/m1/s1 |
| InChIKey | UMOWGDICPOGJCO-MRXNPFEDSA-N |
| XLogP | 3.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |