C20H27N3O3 — CID 7477639
(3S)-N-[2-(cyclopentylcarbamoyl)phenyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide (PubChem CID 7477639) has the molecular formula C20H27N3O3 and a molecular weight of 357.45 g/mol. Its IUPAC name is (3S)-N-[2-(cyclopentylcarbamoyl)phenyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[2-(cyclopentylcarbamoyl)phenyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 7477639 |
| Molecular Formula | C20H27N3O3 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | (3S)-N-[2-(cyclopentylcarbamoyl)phenyl]-5-oxo-1-propan-2-ylpyrrolidine-3-carboxamide |
| SMILES | CC(C)N1C[C@@H](C(=O)Nc2ccccc2C(=O)NC2CCCC2)CC1=O |
| InChI | InChI=1S/C20H27N3O3/c1-13(2)23-12-14(11-18(23)24)19(25)22-17-10-6-5-9-16(17)20(26)21-15-7-3-4-8-15/h5-6,9-10,13-15H,3-4,7-8,11-12H2,1-2H3,(H,21,26)(H,22,25)/t14-/m0/s1 |
| InChIKey | BARPYEMSZCPAHF-AWEZNQCLSA-N |
| XLogP | 2.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |