C25H29N3O2 — CID 26134808
8-(9H-fluoren-2-ylmethyl)-1-methyl-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 26134808) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 8-(9H-fluoren-2-ylmethyl)-1-methyl-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(9H-fluoren-2-ylmethyl)-1-methyl-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 26134808 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 8-(9H-fluoren-2-ylmethyl)-1-methyl-3-propan-2-yl-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | CC(C)N1C(=O)N(C)C2(CCN(Cc3ccc4c(c3)Cc3ccccc3-4)CC2)C1=O |
| InChI | InChI=1S/C25H29N3O2/c1-17(2)28-23(29)25(26(3)24(28)30)10-12-27(13-11-25)16-18-8-9-22-20(14-18)15-19-6-4-5-7-21(19)22/h4-9,14,17H,10-13,15-16H2,1-3H3 |
| InChIKey | LHFIESINGNGTTO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|